About 2-(bromomethyl)oxirane;N,N-diethylethanamine
2-(bromomethyl)oxirane;N,N-diethylethanamine (PubChem CID 87110285) has the molecular formula C9H20BrNO
and a molecular weight of 238.17 g/mol. Its IUPAC name is 2-(bromomethyl)oxirane;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(bromomethyl)oxirane;N,N-diethylethanamine |
| PubChem CID | 87110285 |
| Molecular Formula | C9H20BrNO |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(bromomethyl)oxirane;N,N-diethylethanamine |
| SMILES | BrCC1CO1.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C3H5BrO/c1-4-7(5-2)6-3;4-1-3-2-5-3/h4-6H2,1-3H3;3H,1-2H2 |
| InChIKey | PXBMKLWFXAUVHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)oxirane;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)oxirane;N,N-diethylethanamine?
The IUPAC name of 2-(bromomethyl)oxirane;N,N-diethylethanamine (CID 87110285) is 2-(bromomethyl)oxirane;N,N-diethylethanamine.
What is the SMILES notation for 2-(bromomethyl)oxirane;N,N-diethylethanamine?
The canonical SMILES for 2-(bromomethyl)oxirane;N,N-diethylethanamine is BrCC1CO1.CCN(CC)CC.
What is the InChIKey of 2-(bromomethyl)oxirane;N,N-diethylethanamine?
The InChIKey is PXBMKLWFXAUVHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H5BrO/c1-4-7(5-2)6-3;4-1-3-2-5-3/h4-6H2,1-3H3;3H,1-2H2.
What are the key properties of 2-(bromomethyl)oxirane;N,N-diethylethanamine?
2-(bromomethyl)oxirane;N,N-diethylethanamine has a molecular weight of 238.17 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)oxirane;N,N-diethylethanamine is sourced from PubChem (CID 87110285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).