C48H52O4P2 — CID 87110781
[2-[2-bis(3,5-dimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 87110781) has the molecular formula C48H52O4P2 and a molecular weight of 754.89 g/mol. Its IUPAC name is [2-[2-bis(3,5-dimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [2-[2-bis(3,5-dimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 87110781 |
| Molecular Formula | C48H52O4P2 |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.33 |
| IUPAC Name | [2-[2-bis(3,5-dimethylphenyl)phosphanyl-4,6-dimethoxyphenyl]-3,5-dimethoxyphenyl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | COc1cc(OC)c(-c2c(OC)cc(OC)cc2P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c(P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C48H52O4P2/c1-29-13-30(2)18-39(17-29)53(40-19-31(3)14-32(4)20-40)45-27-37(49-9)25-43(51-11)47(45)48-44(52-12)26-38(50-10)28-46(48)54(41-21-33(5)15-34(6)22-41)42-23-35(7)16-36(8)24-42/h13-28H,1-12H3 |
| InChIKey | IDNKFBDRZBLTFQ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|