C27H34F2N6O3 — CID 87111022
tert-butyl N-[(3R,4S)-1-[5-[(1S)-1-(1-cyanopiperidin-4-yl)ethoxy]pyrimidin-2-yl]-4-(2,5-difluorophenyl)pyrrolidin-3-yl]carbamate (PubChem CID 87111022) has the molecular formula C27H34F2N6O3 and a molecular weight of 528.60 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-1-[5-[(1S)-1-(1-cyanopiperidin-4-yl)ethoxy]pyrimidin-2-yl]-4-(2,5-difluorophenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-1-[5-[(1S)-1-(1-cyanopiperidin-4-yl)ethoxy]pyrimidin-2-yl]-4-(2,5-difluorophenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87111022 |
| Molecular Formula | C27H34F2N6O3 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | tert-butyl N-[(3R,4S)-1-[5-[(1S)-1-(1-cyanopiperidin-4-yl)ethoxy]pyrimidin-2-yl]-4-(2,5-difluorophenyl)pyrrolidin-3-yl]carbamate |
| SMILES | C[C@H](Oc1cnc(N2C[C@H](NC(=O)OC(C)(C)C)[C@@H](c3cc(F)ccc3F)C2)nc1)C1CCN(C#N)CC1 |
| InChI | InChI=1S/C27H34F2N6O3/c1-17(18-7-9-34(16-30)10-8-18)37-20-12-31-25(32-13-20)35-14-22(21-11-19(28)5-6-23(21)29)24(15-35)33-26(36)38-27(2,3)4/h5-6,11-13,17-18,22,24H,7-10,14-15H2,1-4H3,(H,33,36)/t17-,22+,24-/m0/s1 |
| InChIKey | MIRNAMRNTXCJEL-YJGRUCBDSA-N |
| XLogP | 4.21 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|