About oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate
oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate (PubChem CID 87111260) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate |
| PubChem CID | 87111260 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CCOC(=O)C1=CCC1 |
| InChI | InChI=1S/C8H10O2.C7H10O3/c1-2-6-10-8(9)7-4-3-5-7;1-5(2)7(8)10-4-6-3-9-6/h2,4H,1,3,5-6H2;6H,1,3-4H2,2H3 |
| InChIKey | ILTKEHFAGSCEAT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate?
The IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate (CID 87111260) is oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate.
What is the SMILES notation for oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate?
The canonical SMILES for oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate is C=C(C)C(=O)OCC1CO1.C=CCOC(=O)C1=CCC1.
What is the InChIKey of oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate?
The InChIKey is ILTKEHFAGSCEAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C7H10O3/c1-2-6-10-8(9)7-4-3-5-7;1-5(2)7(8)10-4-6-3-9-6/h2,4H,1,3,5-6H2;6H,1,3-4H2,2H3.
What are the key properties of oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate?
oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate has a molecular weight of 280.32 g/mol, XLogP of 1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enyl cyclobutene-1-carboxylate is sourced from PubChem (CID 87111260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).