C25H25ClF3N3O4 — CID 87111280
ethyl 3-[2-(tert-butylamino)-1-[formyl-[(3,4,5-trifluorophenyl)methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate (PubChem CID 87111280) has the molecular formula C25H25ClF3N3O4 and a molecular weight of 523.94 g/mol. Its IUPAC name is ethyl 3-[2-(tert-butylamino)-1-[formyl-[(3,4,5-trifluorophenyl)methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[2-(tert-butylamino)-1-[formyl-[(3,4,5-trifluorophenyl)methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 87111280 |
| Molecular Formula | C25H25ClF3N3O4 |
| Molecular Weight | 523.94 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | ethyl 3-[2-(tert-butylamino)-1-[formyl-[(3,4,5-trifluorophenyl)methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(C(=O)NC(C)(C)C)N(C=O)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C25H25ClF3N3O4/c1-5-36-24(35)21-19(15-7-6-14(26)10-18(15)30-21)22(23(34)31-25(2,3)4)32(12-33)11-13-8-16(27)20(29)17(28)9-13/h6-10,12,22,30H,5,11H2,1-4H3,(H,31,34) |
| InChIKey | OOWUETJGFQSHBR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|