C9H7ClF3IN4O — CID 87111518
3-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87111518) has the molecular formula C9H7ClF3IN4O and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87111518 |
| Molecular Formula | C9H7ClF3IN4O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 3-[(6-chloro-3-iodoimidazo[1,2-b]pyridazin-8-yl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNc1cc(Cl)nn2c(I)cnc12)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3IN4O/c10-6-1-4(15-2-5(19)9(11,12)13)8-16-3-7(14)18(8)17-6/h1,3,5,15,19H,2H2 |
| InChIKey | LKWDARKUZCSXNI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|