C16H11F5N4 — CID 87111602
6-[3,3,4,4-tetrafluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine (PubChem CID 87111602) has the molecular formula C16H11F5N4 and a molecular weight of 354.28 g/mol. Its IUPAC name is 6-[3,3,4,4-tetrafluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine.
| Compound Name | 6-[3,3,4,4-tetrafluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 87111602 |
| Molecular Formula | C16H11F5N4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 6-[3,3,4,4-tetrafluoro-2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine |
| SMILES | Fc1cccc(C2N(c3ccc4nccn4n3)CC(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C16H11F5N4/c17-11-3-1-2-10(8-11)14-16(20,21)15(18,19)9-24(14)13-5-4-12-22-6-7-25(12)23-13/h1-8,14H,9H2 |
| InChIKey | PIZQVOBHGYRWTQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|