About 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine
3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine (PubChem CID 87111772) has the molecular formula C26H24N2O2
and a molecular weight of 396.49 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine |
| PubChem CID | 87111772 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(N)c(N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-29-20-12-8-18(9-13-20)22-16-23(17-6-4-3-5-7-17)25(27)26(28)24(22)19-10-14-21(30-2)15-11-19/h3-16H,27-28H2,1-2H3 |
| InChIKey | FWALOJAOLFOQKY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine?
The IUPAC name of 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine (CID 87111772) is 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine.
What is the SMILES notation for 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine?
The canonical SMILES for 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine is COc1ccc(-c2cc(-c3ccccc3)c(N)c(N)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine?
The InChIKey is FWALOJAOLFOQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O2/c1-29-20-12-8-18(9-13-20)22-16-23(17-6-4-3-5-7-17)25(27)26(28)24(22)19-10-14-21(30-2)15-11-19/h3-16H,27-28H2,1-2H3.
What are the key properties of 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine?
3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine has a molecular weight of 396.49 g/mol, XLogP of 5.87, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine is sourced from PubChem (CID 87111772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).