C26H24N2O2 — CID 87111772
3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine (PubChem CID 87111772) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine.
| Compound Name | 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 87111772 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-6-phenylbenzene-1,2-diamine |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(N)c(N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-29-20-12-8-18(9-13-20)22-16-23(17-6-4-3-5-7-17)25(27)26(28)24(22)19-10-14-21(30-2)15-11-19/h3-16H,27-28H2,1-2H3 |
| InChIKey | FWALOJAOLFOQKY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|