About 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol
4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol (PubChem CID 87111855) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol.
Molecular Properties
| Compound Name | 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol |
| PubChem CID | 87111855 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol |
| SMILES | C=C=C1CC2CC(CC1(C)O)C2(C)C |
| InChI | InChI=1S/C13H20O/c1-5-9-6-10-7-11(12(10,2)3)8-13(9,4)14/h10-11,14H,1,6-8H2,2-4H3 |
| InChIKey | IJSHVPJCTMZELM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol?
The IUPAC name of 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol (CID 87111855) is 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol.
What is the SMILES notation for 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol?
The canonical SMILES for 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol is C=C=C1CC2CC(CC1(C)O)C2(C)C.
What is the InChIKey of 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol?
The InChIKey is IJSHVPJCTMZELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-5-9-6-10-7-11(12(10,2)3)8-13(9,4)14/h10-11,14H,1,6-8H2,2-4H3.
What are the key properties of 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol?
4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol has a molecular weight of 192.30 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylidene-3,7,7-trimethylbicyclo[4.1.1]octan-3-ol is sourced from PubChem (CID 87111855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).