About 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine
2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine (PubChem CID 87112802) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine |
| PubChem CID | 87112802 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine |
| SMILES | CC(C)(CN)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-7(2,6-12)15(13,14)5-3-4-8(9,10)11/h3-6,12H2,1-2H3 |
| InChIKey | BFJKRIZPVMQJFQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The IUPAC name of 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine (CID 87112802) is 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine.
What is the SMILES notation for 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The canonical SMILES for 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine is CC(C)(CN)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
The InChIKey is BFJKRIZPVMQJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-7(2,6-12)15(13,14)5-3-4-8(9,10)11/h3-6,12H2,1-2H3.
What are the key properties of 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine?
2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine has a molecular weight of 247.28 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(4,4,4-trifluorobutylsulfonyl)propan-1-amine is sourced from PubChem (CID 87112802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).