C10H17F3O2S — CID 87112804
methyl 2,2-dimethyl-3-(4,4,4-trifluorobutylsulfanyl)propanoate (PubChem CID 87112804) has the molecular formula C10H17F3O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(4,4,4-trifluorobutylsulfanyl)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-(4,4,4-trifluorobutylsulfanyl)propanoate |
|---|---|
| PubChem CID | 87112804 |
| Molecular Formula | C10H17F3O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl 2,2-dimethyl-3-(4,4,4-trifluorobutylsulfanyl)propanoate |
| SMILES | COC(=O)C(C)(C)CSCCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3O2S/c1-9(2,8(14)15-3)7-16-6-4-5-10(11,12)13/h4-7H2,1-3H3 |
| InChIKey | FNXBQMKYQQIELK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|