About CID 87112916
CID 87112916 (PubChem CID 87112916) has the molecular formula C8H8BClN2
and a molecular weight of 178.43 g/mol.
Molecular Properties
| Compound Name | CID 87112916 |
| PubChem CID | 87112916 |
| Molecular Formula | C8H8BClN2 |
| Molecular Weight | 178.43 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | — |
| SMILES | [B]/C(=C/C)N1N=C(Cl)C=CC1=C |
| InChI | InChI=1S/C8H8BClN2/c1-3-7(9)12-6(2)4-5-8(10)11-12/h3-5H,2H2,1H3/b7-3- |
| InChIKey | ZFPSCZOXGOXSOV-CLTKARDFSA-N |
| XLogP | 1.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87112916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87112916?
The IUPAC name of CID 87112916 (CID 87112916) is not available.
What is the SMILES notation for CID 87112916?
The canonical SMILES for CID 87112916 is [B]/C(=C/C)N1N=C(Cl)C=CC1=C.
What is the InChIKey of CID 87112916?
The InChIKey is ZFPSCZOXGOXSOV-CLTKARDFSA-N. The full InChI is InChI=1S/C8H8BClN2/c1-3-7(9)12-6(2)4-5-8(10)11-12/h3-5H,2H2,1H3/b7-3-.
What are the key properties of CID 87112916?
CID 87112916 has a molecular weight of 178.43 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87112916 is sourced from PubChem (CID 87112916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).