C26H24F2N6O2 — CID 87112965
N-cyclopropyl-4-[6-(3,4-difluorophenoxy)-8-(2-iminopropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide (PubChem CID 87112965) has the molecular formula C26H24F2N6O2 and a molecular weight of 490.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-(3,4-difluorophenoxy)-8-(2-iminopropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide.
| Compound Name | N-cyclopropyl-4-[6-(3,4-difluorophenoxy)-8-(2-iminopropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 87112965 |
| Molecular Formula | C26H24F2N6O2 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-cyclopropyl-4-[6-(3,4-difluorophenoxy)-8-(2-iminopropylamino)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
| SMILES | [H]/N=C(\C)CNc1cc(Oc2ccc(F)c(F)c2)nn2c(-c3ccc(C(=O)NC4CC4)c(C)c3)cnc12 |
| InChI | InChI=1S/C26H24F2N6O2/c1-14-9-16(3-7-19(14)26(35)32-17-4-5-17)23-13-31-25-22(30-12-15(2)29)11-24(33-34(23)25)36-18-6-8-20(27)21(28)10-18/h3,6-11,13,17,29-30H,4-5,12H2,1-2H3,(H,32,35)/b29-15+ |
| InChIKey | XEDMKUUCPICXSX-WKULSOCRSA-N |
| XLogP | 5.12 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|