C12H24N2 — CID 87113234
(4E)-5-N,5-N-diethyl-2-N-methylhepta-4,6-diene-2,5-diamine (PubChem CID 87113234) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (4E)-5-N,5-N-diethyl-2-N-methylhepta-4,6-diene-2,5-diamine.
| Compound Name | (4E)-5-N,5-N-diethyl-2-N-methylhepta-4,6-diene-2,5-diamine |
|---|---|
| PubChem CID | 87113234 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (4E)-5-N,5-N-diethyl-2-N-methylhepta-4,6-diene-2,5-diamine |
| SMILES | C=C/C(=C\CC(C)NC)N(CC)CC |
| InChI | InChI=1S/C12H24N2/c1-6-12(14(7-2)8-3)10-9-11(4)13-5/h6,10-11,13H,1,7-9H2,2-5H3/b12-10+ |
| InChIKey | GGNLYBMXKLOQDV-ZRDIBKRKSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|