C10H8O3 — CID 87113568
methyl 3-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)prop-2-enoate (PubChem CID 87113568) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is methyl 3-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)prop-2-enoate.
| Compound Name | methyl 3-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 87113568 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | methyl 3-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cccc2c1O2 |
| InChI | InChI=1S/C10H8O3/c1-12-9(11)6-5-7-3-2-4-8-10(7)13-8/h2-6H,1H3 |
| InChIKey | XFHQCNLROHJGHI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|