About 2,3-dihydroxypropyl benzenesulfonate
2,3-dihydroxypropyl benzenesulfonate (PubChem CID 87113952) has the molecular formula C9H12O5S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 2,3-dihydroxypropyl benzenesulfonate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl benzenesulfonate |
| PubChem CID | 87113952 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2,3-dihydroxypropyl benzenesulfonate |
| SMILES | O=S(=O)(OCC(O)CO)c1ccccc1 |
| InChI | InChI=1S/C9H12O5S/c10-6-8(11)7-14-15(12,13)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2 |
| InChIKey | KTHIHIZFNLFSSD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl benzenesulfonate?
The IUPAC name of 2,3-dihydroxypropyl benzenesulfonate (CID 87113952) is 2,3-dihydroxypropyl benzenesulfonate.
What is the SMILES notation for 2,3-dihydroxypropyl benzenesulfonate?
The canonical SMILES for 2,3-dihydroxypropyl benzenesulfonate is O=S(=O)(OCC(O)CO)c1ccccc1.
What is the InChIKey of 2,3-dihydroxypropyl benzenesulfonate?
The InChIKey is KTHIHIZFNLFSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5S/c10-6-8(11)7-14-15(12,13)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2.
What are the key properties of 2,3-dihydroxypropyl benzenesulfonate?
2,3-dihydroxypropyl benzenesulfonate has a molecular weight of 232.26 g/mol, XLogP of -0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl benzenesulfonate is sourced from PubChem (CID 87113952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).