C23H31ClN4O8 — CID 87114026
(3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-6-chloro-4,5-dioxohexanoic acid (PubChem CID 87114026) has the molecular formula C23H31ClN4O8 and a molecular weight of 526.97 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-6-chloro-4,5-dioxohexanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-6-chloro-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 87114026 |
| Molecular Formula | C23H31ClN4O8 |
| Molecular Weight | 526.97 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-6-chloro-4,5-dioxohexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)C(=O)CCl |
| InChI | InChI=1S/C23H31ClN4O8/c1-11(2)19(28-22(35)15(25)8-13-4-6-14(29)7-5-13)23(36)26-12(3)21(34)27-16(9-18(31)32)20(33)17(30)10-24/h4-7,11-12,15-16,19,29H,8-10,25H2,1-3H3,(H,26,36)(H,27,34)(H,28,35)(H,31,32)/t12-,15-,16-,19-/m0/s1 |
| InChIKey | RWLRZXOWHQBZLB-DLLGKBFGSA-N |
| XLogP | -0.76 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.97 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|