About 2-chlorobutane;ethanamine
2-chlorobutane;ethanamine (PubChem CID 87114253) has the molecular formula C6H16ClN
and a molecular weight of 137.65 g/mol. Its IUPAC name is 2-chlorobutane;ethanamine.
Molecular Properties
| Compound Name | 2-chlorobutane;ethanamine |
| PubChem CID | 87114253 |
| Molecular Formula | C6H16ClN |
| Molecular Weight | 137.65 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-chlorobutane;ethanamine |
| SMILES | CCC(C)Cl.CCN |
| InChI | InChI=1S/C4H9Cl.C2H7N/c1-3-4(2)5;1-2-3/h4H,3H2,1-2H3;2-3H2,1H3 |
| InChIKey | SXMPOZHIJNBQEN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutane;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutane;ethanamine?
The IUPAC name of 2-chlorobutane;ethanamine (CID 87114253) is 2-chlorobutane;ethanamine.
What is the SMILES notation for 2-chlorobutane;ethanamine?
The canonical SMILES for 2-chlorobutane;ethanamine is CCC(C)Cl.CCN.
What is the InChIKey of 2-chlorobutane;ethanamine?
The InChIKey is SXMPOZHIJNBQEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl.C2H7N/c1-3-4(2)5;1-2-3/h4H,3H2,1-2H3;2-3H2,1H3.
What are the key properties of 2-chlorobutane;ethanamine?
2-chlorobutane;ethanamine has a molecular weight of 137.65 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutane;ethanamine is sourced from PubChem (CID 87114253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).