C34H42FNO6Si — CID 87114878
(2R,5R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpyrrolidin-1-ium-1-carboxylate (PubChem CID 87114878) has the molecular formula C34H42FNO6Si and a molecular weight of 607.80 g/mol. Its IUPAC name is (2R,5R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2R,5R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87114878 |
| Molecular Formula | C34H42FNO6Si |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | (2R,5R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[4-[(2-fluorophenyl)methoxy]phenyl]-2-methoxycarbonylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COC(=O)[C@]1(CO[Si](C)(C)C(C)(C)C)CC[C@H](c2ccc(OCc3ccccc3F)cc2)[N+]1(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C34H42FNO6Si/c1-33(2,3)43(5,6)42-24-34(31(37)40-4)21-20-30(36(34,32(38)39)22-25-12-8-7-9-13-25)26-16-18-28(19-17-26)41-23-27-14-10-11-15-29(27)35/h7-19,30H,20-24H2,1-6H3/t30-,34-,36?/m1/s1 |
| InChIKey | DNGSLTAJMGJLJF-WFYANKAFSA-N |
| XLogP | 6.53 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|