C32H36N2O7S — CID 87114995
2-[2-[2-[2-(4-morpholin-4-ylphenyl)quinolin-6-yl]oxyethoxy]ethoxy]ethyl 2,3,5,6-tetratritio-4-(tritiomethyl)benzenesulfonate (PubChem CID 87114995) has the molecular formula C32H36N2O7S and a molecular weight of 602.75 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-morpholin-4-ylphenyl)quinolin-6-yl]oxyethoxy]ethoxy]ethyl 2,3,5,6-tetratritio-4-(tritiomethyl)benzenesulfonate.
| Compound Name | 2-[2-[2-[2-(4-morpholin-4-ylphenyl)quinolin-6-yl]oxyethoxy]ethoxy]ethyl 2,3,5,6-tetratritio-4-(tritiomethyl)benzenesulfonate |
|---|---|
| PubChem CID | 87114995 |
| Molecular Formula | C32H36N2O7S |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-[2-[2-[2-(4-morpholin-4-ylphenyl)quinolin-6-yl]oxyethoxy]ethoxy]ethyl 2,3,5,6-tetratritio-4-(tritiomethyl)benzenesulfonate |
| SMILES | [3H]Cc1c([3H])c([3H])c(S(=O)(=O)OCCOCCOCCOc2ccc3nc(-c4ccc(N5CCOCC5)cc4)ccc3c2)c([3H])c1[3H] |
| InChI | InChI=1S/C32H36N2O7S/c1-25-2-10-30(11-3-25)42(35,36)41-23-21-39-19-18-38-20-22-40-29-9-13-32-27(24-29)6-12-31(33-32)26-4-7-28(8-5-26)34-14-16-37-17-15-34/h2-13,24H,14-23H2,1H3/i1T,2T,3T,10T,11T |
| InChIKey | OQYQGTKONBKOOS-CJDFBVBWSA-N |
| XLogP | 4.86 |
| TPSA | 96.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|