About (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol
(2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol (PubChem CID 87115699) has the molecular formula C10H26N2O2
and a molecular weight of 206.33 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol |
| PubChem CID | 87115699 |
| Molecular Formula | C10H26N2O2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)N.CC(C)C(CO)N |
| InChI | InChI=1S/2C5H13NO/c2*1-4(2)5(6)3-7/h2*4-5,7H,3,6H2,1-2H3/t5-;/m1./s1 |
| InChIKey | SUZZEFBECOIRIY-NUBCRITNSA-N |
| XLogP | — |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 45 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol (CID 87115699) is (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol is CC(C)[C@@H](CO)N.CC(C)C(CO)N.
What is the InChIKey of (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol?
The InChIKey is SUZZEFBECOIRIY-NUBCRITNSA-N. The full InChI is InChI=1S/2C5H13NO/c2*1-4(2)5(6)3-7/h2*4-5,7H,3,6H2,1-2H3/t5-;/m1./s1.
What are the key properties of (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol?
(2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol has a molecular weight of 206.33 g/mol, XLogP of not available, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutan-1-ol;2-amino-3-methylbutan-1-ol is sourced from PubChem (CID 87115699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).