About bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel
bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel (PubChem CID 87117902) has the molecular formula C34H58NiO8P2
and a molecular weight of 715.47 g/mol. Its IUPAC name is bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel.
Molecular Properties
| Compound Name | bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel |
| PubChem CID | 87117902 |
| Molecular Formula | C34H58NiO8P2 |
| Molecular Weight | 715.47 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel |
| SMILES | CCOc1c(C(C)(C)C)cc(CP(=O)(O)O)cc1C(C)(C)C.CCOc1c(C(C)(C)C)cc(CP(=O)(O)O)cc1C(C)(C)C.[Ni] |
| InChI | InChI=1S/2C17H29O4P.Ni/c2*1-8-21-15-13(16(2,3)4)9-12(11-22(18,19)20)10-14(15)17(5,6)7;/h2*9-10H,8,11H2,1-7H3,(H2,18,19,20); |
| InChIKey | WWSCUTWUKXTFRH-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 715.47 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel?
The IUPAC name of bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel (CID 87117902) is bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel.
What is the SMILES notation for bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel?
The canonical SMILES for bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel is CCOc1c(C(C)(C)C)cc(CP(=O)(O)O)cc1C(C)(C)C.CCOc1c(C(C)(C)C)cc(CP(=O)(O)O)cc1C(C)(C)C.[Ni].
What is the InChIKey of bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel?
The InChIKey is WWSCUTWUKXTFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H29O4P.Ni/c2*1-8-21-15-13(16(2,3)4)9-12(11-22(18,19)20)10-14(15)17(5,6)7;/h2*9-10H,8,11H2,1-7H3,(H2,18,19,20);.
What are the key properties of bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel?
bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel has a molecular weight of 715.47 g/mol, XLogP of 8.71, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((3,5-ditert-butyl-4-ethoxyphenyl)methylphosphonic acid);nickel is sourced from PubChem (CID 87117902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).