About tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride
tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride (PubChem CID 87117945) has the molecular formula C19H30ClN3
and a molecular weight of 335.92 g/mol. Its IUPAC name is tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride.
Molecular Properties
| Compound Name | tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride |
| PubChem CID | 87117945 |
| Molecular Formula | C19H30ClN3 |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride |
| SMILES | C=CC/N=C(\N(CC=C)CC=C)[N+](CC=C)(CC=C)CC=C.[Cl-] |
| InChI | InChI=1S/C19H30N3.ClH/c1-7-13-20-19(21(14-8-2)15-9-3)22(16-10-4,17-11-5)18-12-6;/h7-12H,1-6,13-18H2;1H/q+1;/p-1/b20-19+; |
| InChIKey | VGDIBBNXYXQFJV-RZLHGTIFSA-M |
| XLogP | 0.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride?
The IUPAC name of tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride (CID 87117945) is tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride.
What is the SMILES notation for tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride?
The canonical SMILES for tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride is C=CC/N=C(\N(CC=C)CC=C)[N+](CC=C)(CC=C)CC=C.[Cl-].
What is the InChIKey of tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride?
The InChIKey is VGDIBBNXYXQFJV-RZLHGTIFSA-M. The full InChI is InChI=1S/C19H30N3.ClH/c1-7-13-20-19(21(14-8-2)15-9-3)22(16-10-4,17-11-5)18-12-6;/h7-12H,1-6,13-18H2;1H/q+1;/p-1/b20-19+;.
What are the key properties of tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride?
tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride has a molecular weight of 335.92 g/mol, XLogP of 0.58, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tris(prop-2-enyl)-[N,N,N'-tris(prop-2-enyl)carbamimidoyl]azanium chloride is sourced from PubChem (CID 87117945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).