About 5-sulfanylcyclohexa-2,4-dien-1-ol
5-sulfanylcyclohexa-2,4-dien-1-ol (PubChem CID 87117976) has the molecular formula C6H8OS
and a molecular weight of 128.20 g/mol. Its IUPAC name is 5-sulfanylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 5-sulfanylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 87117976 |
| Molecular Formula | C6H8OS |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 5-sulfanylcyclohexa-2,4-dien-1-ol |
| SMILES | OC1C=CC=C(S)C1 |
| InChI | InChI=1S/C6H8OS/c7-5-2-1-3-6(8)4-5/h1-3,5,7-8H,4H2 |
| InChIKey | SBSZPKWEWYDYBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 5-sulfanylcyclohexa-2,4-dien-1-ol (CID 87117976) is 5-sulfanylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 5-sulfanylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 5-sulfanylcyclohexa-2,4-dien-1-ol is OC1C=CC=C(S)C1.
What is the InChIKey of 5-sulfanylcyclohexa-2,4-dien-1-ol?
The InChIKey is SBSZPKWEWYDYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS/c7-5-2-1-3-6(8)4-5/h1-3,5,7-8H,4H2.
What are the key properties of 5-sulfanylcyclohexa-2,4-dien-1-ol?
5-sulfanylcyclohexa-2,4-dien-1-ol has a molecular weight of 128.20 g/mol, XLogP of 1.12, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 87117976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).