C4H2F10NOP — CID 87118110
1-[amino(1,1,2,2,2-pentafluoroethyl)phosphoryl]-1,1,2,2,2-pentafluoroethane (PubChem CID 87118110) has the molecular formula C4H2F10NOP and a molecular weight of 301.02 g/mol. Its IUPAC name is 1-[amino(1,1,2,2,2-pentafluoroethyl)phosphoryl]-1,1,2,2,2-pentafluoroethane.
| Compound Name | 1-[amino(1,1,2,2,2-pentafluoroethyl)phosphoryl]-1,1,2,2,2-pentafluoroethane |
|---|---|
| PubChem CID | 87118110 |
| Molecular Formula | C4H2F10NOP |
| Molecular Weight | 301.02 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 1-[amino(1,1,2,2,2-pentafluoroethyl)phosphoryl]-1,1,2,2,2-pentafluoroethane |
| SMILES | NP(=O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F10NOP/c5-1(6,7)3(11,12)17(15,16)4(13,14)2(8,9)10/h(H2,15,16) |
| InChIKey | SURFJOUGDBQJTP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.02 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|