About [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate (PubChem CID 87118529) has the molecular formula C29H24F2O5S2
and a molecular weight of 554.64 g/mol. Its IUPAC name is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate |
| PubChem CID | 87118529 |
| Molecular Formula | C29H24F2O5S2 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.10 |
| IUPAC Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)OCC(F)(F)S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24F2O5S2/c1-2-23-18-20-24(21-19-23)28(32)35-22-29(30,31)38(33,34)36-37(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-21H,1,22H2 |
| InChIKey | LOORODZHEPVSHF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate?
The IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate (CID 87118529) is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate.
What is the SMILES notation for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate?
The canonical SMILES for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate is C=Cc1ccc(C(=O)OCC(F)(F)S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate?
The InChIKey is LOORODZHEPVSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24F2O5S2/c1-2-23-18-20-24(21-19-23)28(32)35-22-29(30,31)38(33,34)36-37(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-21H,1,22H2.
What are the key properties of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate?
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate has a molecular weight of 554.64 g/mol, XLogP of 7.32, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-ethenylbenzoate is sourced from PubChem (CID 87118529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).