C44H36F18O7S4 — CID 87118736
[2-[1-(4-butoxynaphthalen-1-yl)thiolan-1-ium-2-yl]phenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) (PubChem CID 87118736) has the molecular formula C44H36F18O7S4 and a molecular weight of 1147.00 g/mol. Its IUPAC name is [2-[1-(4-butoxynaphthalen-1-yl)thiolan-1-ium-2-yl]phenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate).
| Compound Name | [2-[1-(4-butoxynaphthalen-1-yl)thiolan-1-ium-2-yl]phenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) |
|---|---|
| PubChem CID | 87118736 |
| Molecular Formula | C44H36F18O7S4 |
| Molecular Weight | 1147.00 g/mol |
| Exact Mass | 1146.11 |
| IUPAC Name | [2-[1-(4-butoxynaphthalen-1-yl)thiolan-1-ium-2-yl]phenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate) |
| SMILES | CCCCOc1ccc([S+]2CCCC2c2ccccc2[S+](c2ccccc2)c2ccccc2)c2ccccc12.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H36OS2.2C4HF9O3S/c1-2-3-26-37-33-24-25-35(31-20-11-10-19-30(31)33)38-27-14-23-34(38)32-21-12-13-22-36(32)39(28-15-6-4-7-16-28)29-17-8-5-9-18-29;2*5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-13,15-22,24-25,34H,2-3,14,23,26-27H2,1H3;2*(H,14,15,16)/q+2;;/p-2 |
| InChIKey | UBHKOEJJUSPECN-UHFFFAOYSA-L |
| XLogP | 13.54 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.00 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|