C18H28N2 — CID 87118745
5,6-dimethylidene-4,7-bis(prop-2-enyl)deca-1,9-diene-4,7-diamine (PubChem CID 87118745) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 5,6-dimethylidene-4,7-bis(prop-2-enyl)deca-1,9-diene-4,7-diamine.
| Compound Name | 5,6-dimethylidene-4,7-bis(prop-2-enyl)deca-1,9-diene-4,7-diamine |
|---|---|
| PubChem CID | 87118745 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 5,6-dimethylidene-4,7-bis(prop-2-enyl)deca-1,9-diene-4,7-diamine |
| SMILES | C=CCC(N)(CC=C)C(=C)C(=C)C(N)(CC=C)CC=C |
| InChI | InChI=1S/C18H28N2/c1-7-11-17(19,12-8-2)15(5)16(6)18(20,13-9-3)14-10-4/h7-10H,1-6,11-14,19-20H2 |
| InChIKey | BPBJHRHHXLUFIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|