About benzo[e][1,2,3]benzoselenadiazole
benzo[e][1,2,3]benzoselenadiazole (PubChem CID 87118927) has the molecular formula C10H6N2Se
and a molecular weight of 233.13 g/mol. Its IUPAC name is benzo[e][1,2,3]benzoselenadiazole.
Molecular Properties
| Compound Name | benzo[e][1,2,3]benzoselenadiazole |
| PubChem CID | 87118927 |
| Molecular Formula | C10H6N2Se |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | benzo[e][1,2,3]benzoselenadiazole |
| SMILES | c1ccc2c(c1)ccc1[se]nnc12 |
| InChI | InChI=1S/C10H6N2Se/c1-2-4-8-7(3-1)5-6-9-10(8)11-12-13-9/h1-6H |
| InChIKey | JAVXCBRSNIIMDB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzo[e][1,2,3]benzoselenadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1,2,3]benzoselenadiazole?
The IUPAC name of benzo[e][1,2,3]benzoselenadiazole (CID 87118927) is benzo[e][1,2,3]benzoselenadiazole.
What is the SMILES notation for benzo[e][1,2,3]benzoselenadiazole?
The canonical SMILES for benzo[e][1,2,3]benzoselenadiazole is c1ccc2c(c1)ccc1[se]nnc12.
What is the InChIKey of benzo[e][1,2,3]benzoselenadiazole?
The InChIKey is JAVXCBRSNIIMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2Se/c1-2-4-8-7(3-1)5-6-9-10(8)11-12-13-9/h1-6H.
What are the key properties of benzo[e][1,2,3]benzoselenadiazole?
benzo[e][1,2,3]benzoselenadiazole has a molecular weight of 233.13 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1,2,3]benzoselenadiazole is sourced from PubChem (CID 87118927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).