C8H10F6O2 — CID 87119262
1-ethenoxy-1,1,2,3,3,3-hexafluoro-2-propoxypropane (PubChem CID 87119262) has the molecular formula C8H10F6O2 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1-ethenoxy-1,1,2,3,3,3-hexafluoro-2-propoxypropane.
| Compound Name | 1-ethenoxy-1,1,2,3,3,3-hexafluoro-2-propoxypropane |
|---|---|
| PubChem CID | 87119262 |
| Molecular Formula | C8H10F6O2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-ethenoxy-1,1,2,3,3,3-hexafluoro-2-propoxypropane |
| SMILES | C=COC(F)(F)C(F)(OCCC)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O2/c1-3-5-16-6(9,7(10,11)12)8(13,14)15-4-2/h4H,2-3,5H2,1H3 |
| InChIKey | YTJAFXSMYRLNBF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|