About azanium;ethanol;acetate
azanium;ethanol;acetate (PubChem CID 87119319) has the molecular formula C4H13NO3
and a molecular weight of 123.15 g/mol. Its IUPAC name is azanium;ethanol;acetate.
Molecular Properties
| Compound Name | azanium;ethanol;acetate |
| PubChem CID | 87119319 |
| Molecular Formula | C4H13NO3 |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | azanium;ethanol;acetate |
| SMILES | CC(=O)[O-].CCO.[NH4+] |
| InChI | InChI=1S/C2H4O2.C2H6O.H3N/c1-2(3)4;1-2-3;/h1H3,(H,3,4);3H,2H2,1H3;1H3 |
| InChIKey | ANAKGLHGKIVHLU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azanium;ethanol;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;ethanol;acetate?
The IUPAC name of azanium;ethanol;acetate (CID 87119319) is azanium;ethanol;acetate.
What is the SMILES notation for azanium;ethanol;acetate?
The canonical SMILES for azanium;ethanol;acetate is CC(=O)[O-].CCO.[NH4+].
What is the InChIKey of azanium;ethanol;acetate?
The InChIKey is ANAKGLHGKIVHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.C2H6O.H3N/c1-2(3)4;1-2-3;/h1H3,(H,3,4);3H,2H2,1H3;1H3.
What are the key properties of azanium;ethanol;acetate?
azanium;ethanol;acetate has a molecular weight of 123.15 g/mol, XLogP of -0.87, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;ethanol;acetate is sourced from PubChem (CID 87119319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).