C35H38F4O5S2 — CID 87119661
[5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] adamantane-1-carboxylate (PubChem CID 87119661) has the molecular formula C35H38F4O5S2 and a molecular weight of 678.81 g/mol. Its IUPAC name is [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] adamantane-1-carboxylate.
| Compound Name | [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 87119661 |
| Molecular Formula | C35H38F4O5S2 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | [5,5,6,6-tetrafluoro-6-(triphenyl-λ4-sulfanyl)oxysulfonylhexyl] adamantane-1-carboxylate |
| SMILES | O=C(OCCCCC(F)(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H38F4O5S2/c36-34(37,18-10-11-19-43-32(40)33-23-26-20-27(24-33)22-28(21-26)25-33)35(38,39)46(41,42)44-45(29-12-4-1-5-13-29,30-14-6-2-7-15-30)31-16-8-3-9-17-31/h1-9,12-17,26-28H,10-11,18-25H2 |
| InChIKey | PDOGOGZLPYDWEE-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|