About 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate
4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate (PubChem CID 87119690) has the molecular formula C33H28O9
and a molecular weight of 568.58 g/mol. Its IUPAC name is 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate.
Molecular Properties
| Compound Name | 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate |
| PubChem CID | 87119690 |
| Molecular Formula | C33H28O9 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate |
| SMILES | O=C(OCC1CO1)OC(=O)OCC1CO1.Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C25H18O2.C8H10O7/c26-19-13-9-17(10-14-19)25(18-11-15-20(27)16-12-18)23-7-3-1-5-21(23)22-6-2-4-8-24(22)25;9-7(13-3-5-1-11-5)15-8(10)14-4-6-2-12-6/h1-16,26-27H;5-6H,1-4H2 |
| InChIKey | BVDHQCCLGQRDKG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate?
The IUPAC name of 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate (CID 87119690) is 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate.
What is the SMILES notation for 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate?
The canonical SMILES for 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate is O=C(OCC1CO1)OC(=O)OCC1CO1.Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1.
What is the InChIKey of 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate?
The InChIKey is BVDHQCCLGQRDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18O2.C8H10O7/c26-19-13-9-17(10-14-19)25(18-11-15-20(27)16-12-18)23-7-3-1-5-21(23)22-6-2-4-8-24(22)25;9-7(13-3-5-1-11-5)15-8(10)14-4-6-2-12-6/h1-16,26-27H;5-6H,1-4H2.
What are the key properties of 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate?
4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate has a molecular weight of 568.58 g/mol, XLogP of 5.53, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[9-(4-hydroxyphenyl)fluoren-9-yl]phenol;oxiran-2-ylmethoxycarbonyl oxiran-2-ylmethyl carbonate is sourced from PubChem (CID 87119690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).