About 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium
2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium (PubChem CID 87119775) has the molecular formula C26H19F3O3S
and a molecular weight of 468.50 g/mol. Its IUPAC name is 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium |
| PubChem CID | 87119775 |
| Molecular Formula | C26H19F3O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H5F3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h1-15H;1-3,12H,(H,13,14)/q+1;/p-1 |
| InChIKey | QILYGKFNKLHGHK-UHFFFAOYSA-M |
| XLogP | 6.26 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium?
The IUPAC name of 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium (CID 87119775) is 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium.
What is the SMILES notation for 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium?
The canonical SMILES for 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium is O=C(O)c1ccc(C(F)(F)F)cc1[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium?
The InChIKey is QILYGKFNKLHGHK-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C8H5F3O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h1-15H;1-3,12H,(H,13,14)/q+1;/p-1.
What are the key properties of 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium?
2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium has a molecular weight of 468.50 g/mol, XLogP of 6.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxy-5-(trifluoromethyl)phenolate;triphenylsulfanium is sourced from PubChem (CID 87119775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).