C14H21ClN3O2+ — CID 8711982
[2-(5-chloro-2-methylanilino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium (PubChem CID 8711982) has the molecular formula C14H21ClN3O2+ and a molecular weight of 298.79 g/mol. Its IUPAC name is [2-(5-chloro-2-methylanilino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8711982 |
| Molecular Formula | C14H21ClN3O2+ |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [2-(5-chloro-2-methylanilino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C[NH+](C)CC(=O)N(C)C |
| InChI | InChI=1S/C14H20ClN3O2/c1-10-5-6-11(15)7-12(10)16-13(19)8-18(4)9-14(20)17(2)3/h5-7H,8-9H2,1-4H3,(H,16,19)/p+1 |
| InChIKey | KNSZDWBVQQBOOV-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |