C12H13F3N2O3 — CID 87119900
2-N-hydroxy-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 87119900) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-N-hydroxy-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 2-N-hydroxy-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87119900 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-N-hydroxy-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | CC(C)(c1ccc(C(N)=O)c(C(=O)NO)c1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3/c1-11(2,12(13,14)15)6-3-4-7(9(16)18)8(5-6)10(19)17-20/h3-5,20H,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | WXXYKEVTMUOBRY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|