C36H71NO2 — CID 87119922
(Z,7R)-18-[[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol (PubChem CID 87119922) has the molecular formula C36H71NO2 and a molecular weight of 549.97 g/mol. Its IUPAC name is (Z,7R)-18-[[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol.
| Compound Name | (Z,7R)-18-[[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol |
|---|---|
| PubChem CID | 87119922 |
| Molecular Formula | C36H71NO2 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.55 |
| IUPAC Name | (Z,7R)-18-[[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCCNCCCCCCCC/C=C\C[C@H](O)CCCCCC |
| InChI | InChI=1S/C36H71NO2/c1-3-5-7-23-29-35(38)31-25-19-15-11-9-13-17-21-27-33-37-34-28-22-18-14-10-12-16-20-26-32-36(39)30-24-8-6-4-2/h19-20,25-26,35-39H,3-18,21-24,27-34H2,1-2H3/b25-19-,26-20-/t35-,36-/m1/s1 |
| InChIKey | AOGFWYYYXOBFAC-UVRBXEATSA-N |
| XLogP | 10.59 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|