C54H105NO3 — CID 87119924
(Z,7R)-18-[bis[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol (PubChem CID 87119924) has the molecular formula C54H105NO3 and a molecular weight of 816.44 g/mol. Its IUPAC name is (Z,7R)-18-[bis[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol.
| Compound Name | (Z,7R)-18-[bis[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol |
|---|---|
| PubChem CID | 87119924 |
| Molecular Formula | C54H105NO3 |
| Molecular Weight | 816.44 g/mol |
| Exact Mass | 815.81 |
| IUPAC Name | (Z,7R)-18-[bis[(Z,12R)-12-hydroxyoctadec-9-enyl]amino]octadec-9-en-7-ol |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C[C@H](O)CCCCCC)CCCCCCCC/C=C\C[C@H](O)CCCCCC |
| InChI | InChI=1S/C54H105NO3/c1-4-7-10-34-43-52(56)46-37-28-22-16-13-19-25-31-40-49-55(50-41-32-26-20-14-17-23-29-38-47-53(57)44-35-11-8-5-2)51-42-33-27-21-15-18-24-30-39-48-54(58)45-36-12-9-6-3/h28-30,37-39,52-54,56-58H,4-27,31-36,40-51H2,1-3H3/b37-28-,38-29-,39-30-/t52-,53-,54-/m1/s1 |
| InChIKey | OMUGCBHAKWOOKB-DZEJNBJVSA-N |
| XLogP | 16.31 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.44 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|