C21H17FN6O3 — CID 87120368
N-cyclopropyl-N-[4-[[5-fluoro-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]formamide (PubChem CID 87120368) has the molecular formula C21H17FN6O3 and a molecular weight of 420.40 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[[5-fluoro-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[[5-fluoro-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]formamide |
|---|---|
| PubChem CID | 87120368 |
| Molecular Formula | C21H17FN6O3 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-cyclopropyl-N-[4-[[5-fluoro-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]formamide |
| SMILES | O=CN(c1ccc(Nc2ncc(F)c(Nc3ccc4oc(=O)[nH]c4c3)n2)cc1)C1CC1 |
| InChI | InChI=1S/C21H17FN6O3/c22-16-10-23-20(25-12-1-4-14(5-2-12)28(11-29)15-6-7-15)27-19(16)24-13-3-8-18-17(9-13)26-21(30)31-18/h1-5,8-11,15H,6-7H2,(H,26,30)(H2,23,24,25,27) |
| InChIKey | XSXNZSGXPZZLMZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|