C20H36O5 — CID 87120540
(Z)-3,5-dihydroxy-4-oxo-3-pentylpentadec-5-enoic acid (PubChem CID 87120540) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is (Z)-3,5-dihydroxy-4-oxo-3-pentylpentadec-5-enoic acid.
| Compound Name | (Z)-3,5-dihydroxy-4-oxo-3-pentylpentadec-5-enoic acid |
|---|---|
| PubChem CID | 87120540 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (Z)-3,5-dihydroxy-4-oxo-3-pentylpentadec-5-enoic acid |
| SMILES | CCCCCCCCC/C=C(\O)C(=O)C(O)(CCCCC)CC(=O)O |
| InChI | InChI=1S/C20H36O5/c1-3-5-7-8-9-10-11-12-14-17(21)19(24)20(25,16-18(22)23)15-13-6-4-2/h14,21,25H,3-13,15-16H2,1-2H3,(H,22,23)/b17-14- |
| InChIKey | KNDAJFFDRUBQFX-VKAVYKQESA-N |
| XLogP | 4.92 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|