C12H14N2O3 — CID 87121485
benzyl-[(2S)-1-cyano-1-hydroxypropan-2-yl]carbamic acid (PubChem CID 87121485) has the molecular formula C12H14N2O3 and a molecular weight of 234.26 g/mol. Its IUPAC name is benzyl-[(2S)-1-cyano-1-hydroxypropan-2-yl]carbamic acid.
| Compound Name | benzyl-[(2S)-1-cyano-1-hydroxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87121485 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | benzyl-[(2S)-1-cyano-1-hydroxypropan-2-yl]carbamic acid |
| SMILES | C[C@@H](C(O)C#N)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H14N2O3/c1-9(11(15)7-13)14(12(16)17)8-10-5-3-2-4-6-10/h2-6,9,11,15H,8H2,1H3,(H,16,17)/t9-,11?/m0/s1 |
| InChIKey | LKBXNGFMNWNAIY-FTNKSUMCSA-N |
| XLogP | 1.44 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|