C9H18ClNO2 — CID 87121866
5-amino-3,3-dimethyl-2-methylidenepentanoic acid;chloromethane (PubChem CID 87121866) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is 5-amino-3,3-dimethyl-2-methylidenepentanoic acid;chloromethane.
| Compound Name | 5-amino-3,3-dimethyl-2-methylidenepentanoic acid;chloromethane |
|---|---|
| PubChem CID | 87121866 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-amino-3,3-dimethyl-2-methylidenepentanoic acid;chloromethane |
| SMILES | C=C(C(=O)O)C(C)(C)CCN.CCl |
| InChI | InChI=1S/C8H15NO2.CH3Cl/c1-6(7(10)11)8(2,3)4-5-9;1-2/h1,4-5,9H2,2-3H3,(H,10,11);1H3 |
| InChIKey | DDOLQEWZKHOPFD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|