About buta-1,3-diene-1,1,3-tricarbonitrile
buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 87122431) has the molecular formula C7H3N3
and a molecular weight of 129.12 g/mol. Its IUPAC name is buta-1,3-diene-1,1,3-tricarbonitrile.
Molecular Properties
| Compound Name | buta-1,3-diene-1,1,3-tricarbonitrile |
| PubChem CID | 87122431 |
| Molecular Formula | C7H3N3 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | C=C(C#N)C=C(C#N)C#N |
| InChI | InChI=1S/C7H3N3/c1-6(3-8)2-7(4-9)5-10/h2H,1H2 |
| InChIKey | QGFYGXTVVSVIKD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene-1,1,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene-1,1,3-tricarbonitrile?
The IUPAC name of buta-1,3-diene-1,1,3-tricarbonitrile (CID 87122431) is buta-1,3-diene-1,1,3-tricarbonitrile.
What is the SMILES notation for buta-1,3-diene-1,1,3-tricarbonitrile?
The canonical SMILES for buta-1,3-diene-1,1,3-tricarbonitrile is C=C(C#N)C=C(C#N)C#N.
What is the InChIKey of buta-1,3-diene-1,1,3-tricarbonitrile?
The InChIKey is QGFYGXTVVSVIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3/c1-6(3-8)2-7(4-9)5-10/h2H,1H2.
What are the key properties of buta-1,3-diene-1,1,3-tricarbonitrile?
buta-1,3-diene-1,1,3-tricarbonitrile has a molecular weight of 129.12 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene-1,1,3-tricarbonitrile is sourced from PubChem (CID 87122431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).