2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid

C7H16O6S — CID 87122527

IUPAC2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid
SMILESO=C(O)CS.OCC(CO)(CO)CO
InChIInChI=1S/C5H12O4.C2H4O2S/c6-1-5(2-7,3-8)4-9;3-2(4)1-5/h6-9H,1-4H2;5H,1H2,(H,3,4)
InChIKeyBVQWCCFXOOZKCX-UHFFFAOYSA-N
MW228.27 g/mol
LogP-2.06
Rot. Bonds5

About 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid

2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid (PubChem CID 87122527) has the molecular formula C7H16O6S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid.

Molecular Properties

Compound Name2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid
PubChem CID87122527
Molecular FormulaC7H16O6S
Molecular Weight228.27 g/mol
Exact Mass228.07
IUPAC Name2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid
SMILESO=C(O)CS.OCC(CO)(CO)CO
InChIInChI=1S/C5H12O4.C2H4O2S/c6-1-5(2-7,3-8)4-9;3-2(4)1-5/h6-9H,1-4H2;5H,1H2,(H,3,4)
InChIKeyBVQWCCFXOOZKCX-UHFFFAOYSA-N
XLogP-2.06
TPSA118.22 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500228.27
LogP ≤ 5-2.06
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid?
The IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid (CID 87122527) is 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid.
What is the SMILES notation for 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid?
The canonical SMILES for 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid is O=C(O)CS.OCC(CO)(CO)CO.
What is the InChIKey of 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid?
The InChIKey is BVQWCCFXOOZKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O4.C2H4O2S/c6-1-5(2-7,3-8)4-9;3-2(4)1-5/h6-9H,1-4H2;5H,1H2,(H,3,4).
What are the key properties of 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid?
2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid has a molecular weight of 228.27 g/mol, XLogP of -2.06, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)propane-1,3-diol;2-sulfanylacetic acid is sourced from PubChem (CID 87122527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).