C11H6N4O4S — CID 871226
2-(3-nitrophenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 871226) has the molecular formula C11H6N4O4S and a molecular weight of 290.26 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 2-(3-nitrophenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 871226 |
| Molecular Formula | C11H6N4O4S |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-(3-nitrophenyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | O=C1CC(=O)N2N=C(c3cccc([N+](=O)[O-])c3)SC2=N1 |
| InChI | InChI=1S/C11H6N4O4S/c16-8-5-9(17)14-11(12-8)20-10(13-14)6-2-1-3-7(4-6)15(18)19/h1-4H,5H2 |
| InChIKey | CTLPCLPKMCAAPY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|