C30H36F6N2O5 — CID 87123262
3-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]propyl]-5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 87123262) has the molecular formula C30H36F6N2O5 and a molecular weight of 618.62 g/mol. Its IUPAC name is 3-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]propyl]-5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]propyl]-5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87123262 |
| Molecular Formula | C30H36F6N2O5 |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 3-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]propyl]-5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCN1C(=O)NC(C)(Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C30H36F6N2O5/c1-5-8-20-16-22(28(41,29(31,32)33)30(34,35)36)17-21(9-6-2)24(20)43-15-7-14-38-25(39)27(3,37-26(38)40)18-19-10-12-23(42-4)13-11-19/h10-13,16-17,41H,5-9,14-15,18H2,1-4H3,(H,37,40) |
| InChIKey | XGCIYGIHIANLMF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|