About (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate
(triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate (PubChem CID 87123343) has the molecular formula C25H28F2O4S2
and a molecular weight of 494.63 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate |
| PubChem CID | 87123343 |
| Molecular Formula | C25H28F2O4S2 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate |
| SMILES | CCCCCOCC(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28F2O4S2/c1-2-3-13-20-30-21-25(26,27)33(28,29)31-32(22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24/h4-12,14-19H,2-3,13,20-21H2,1H3 |
| InChIKey | FBOUHBRGFGUAEJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate?
The IUPAC name of (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate (CID 87123343) is (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate is CCCCCOCC(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate?
The InChIKey is FBOUHBRGFGUAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28F2O4S2/c1-2-3-13-20-30-21-25(26,27)33(28,29)31-32(22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24/h4-12,14-19H,2-3,13,20-21H2,1H3.
What are the key properties of (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate?
(triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate has a molecular weight of 494.63 g/mol, XLogP of 7.03, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) 1,1-difluoro-2-pentoxyethanesulfonate is sourced from PubChem (CID 87123343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).