About [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate
[1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate (PubChem CID 87123489) has the molecular formula C24H22F2O5S2
and a molecular weight of 492.57 g/mol. Its IUPAC name is [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate |
| PubChem CID | 87123489 |
| Molecular Formula | C24H22F2O5S2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)CS(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22F2O5S2/c1-19(2)23(27)30-24(25,26)18-32(28,29)31-33(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,1,18H2,2H3 |
| InChIKey | CTVOFDZQSRTFGN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate?
The IUPAC name of [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate (CID 87123489) is [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate.
What is the SMILES notation for [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate?
The canonical SMILES for [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(F)(F)CS(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate?
The InChIKey is CTVOFDZQSRTFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22F2O5S2/c1-19(2)23(27)30-24(25,26)18-32(28,29)31-33(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,1,18H2,2H3.
What are the key properties of [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate?
[1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate has a molecular weight of 492.57 g/mol, XLogP of 5.94, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 2-methylprop-2-enoate is sourced from PubChem (CID 87123489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).