C13H7Cl3N2O3S2 — CID 87123551
(2-amino-1,3-benzothiazol-6-yl) 2,4,6-trichlorobenzenesulfonate (PubChem CID 87123551) has the molecular formula C13H7Cl3N2O3S2 and a molecular weight of 409.70 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-6-yl) 2,4,6-trichlorobenzenesulfonate.
| Compound Name | (2-amino-1,3-benzothiazol-6-yl) 2,4,6-trichlorobenzenesulfonate |
|---|---|
| PubChem CID | 87123551 |
| Molecular Formula | C13H7Cl3N2O3S2 |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | (2-amino-1,3-benzothiazol-6-yl) 2,4,6-trichlorobenzenesulfonate |
| SMILES | Nc1nc2ccc(OS(=O)(=O)c3c(Cl)cc(Cl)cc3Cl)cc2s1 |
| InChI | InChI=1S/C13H7Cl3N2O3S2/c14-6-3-8(15)12(9(16)4-6)23(19,20)21-7-1-2-10-11(5-7)22-13(17)18-10/h1-5H,(H2,17,18) |
| InChIKey | NTFOBHHNYKVHOY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|