C30H33F5O5S2 — CID 87123727
(4-tert-butylphenyl)-diphenylsulfanium;2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate (PubChem CID 87123727) has the molecular formula C30H33F5O5S2 and a molecular weight of 632.71 g/mol. Its IUPAC name is (4-tert-butylphenyl)-diphenylsulfanium;2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate.
| Compound Name | (4-tert-butylphenyl)-diphenylsulfanium;2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 87123727 |
| Molecular Formula | C30H33F5O5S2 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | (4-tert-butylphenyl)-diphenylsulfanium;2-(2,2-dimethylpropanoyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate |
| SMILES | CC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23S.C8H11F5O5S/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-6(2,3)5(14)18-4(7(9,10)11)8(12,13)19(15,16)17/h4-17H,1-3H3;4H,1-3H3,(H,15,16,17)/q+1;/p-1 |
| InChIKey | YGTUXGGFEXEJFU-UHFFFAOYSA-M |
| XLogP | 7.72 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|